Print GHS / CLP labels including all
required elements
Choose from 161760 labels
Print chemical labels easily that comply with GHS / CLP regulationsChemical-label.com automatically finds the elements that should be on your labels. You no longer have to look up these elements yourself on the safety data sheets. You no longer have to determine which elements should be shown on your labels, we have done this for you.
You no longer need label printing software. You don't need to install anything.
You no longer need to link your database / stock management system to your label printing software.
Thanks to Chemical-label.com labels are printed easily. The application is web-based.
The elements below can be printed on your labels:
- Product identifiers, including substance name, CAS number, EC number and formula
- Hazard statements and precautionary statements in the form of H and P phrases
- Hazard pictograms
- Quantity
- Name, address and telephone number
- ID barcode
- Signal word (Warning / Danger)
- Date and time
- free text
- UFI
To add a label, just take any label, and change it the way you like.
| Name | Cas | EG | Signalword | |
|---|---|---|---|---|
| Bis(4-amino-2,3-dichlorophenyl)methane | 42240-73-3 | 678-036-7 |
Edit chemical label
Print chemical label
[Check your label] |
|
| Bis(4-bromophenyl) sulphide | 3393-78-0 | 222-240-7 | Danger |
Edit chemical label
Print chemical label
[Check your label] |
| Bis(4-bromophenyl)amine | 16292-17-4 | 628-026-3 | Warning |
Edit chemical label
Print chemical label
[Check your label] |
| Bis(4-bromophenyl)ethanedione | 35578-47-3 | 252-628-1 | Danger |
Edit chemical label
Print chemical label
[Check your label] |
| Bis(4-bromophenyl)glycolic acid | 30738-49-9 | 250-318-0 | Danger |
Edit chemical label
Print chemical label
[Check your label] |
| Bis(4-bromophenyl)iodonium Trifluoromethanesulfonate | 139139-81-4 | 802-970-8 | Danger |
Edit chemical label
Print chemical label
[Check your label] |
| Bis(4-bromophenyl)phenylphosphine Oxide | 93869-52-4 | 833-793-4 | Danger |
Edit chemical label
Print chemical label
[Check your label] |
| Bis(4-bromophenylboronic Acid) scyllo-Inositol Complex Dipotassium | 1537876-29-1 | 807-950-2 | Danger |
Edit chemical label
Print chemical label
[Check your label] |
| BIS(4-CHLORO-2-METHYLPHENYL) N,N'-(4-METHYL-1,3-PHENYLENE)BISCARBAMATE | 67768-78-9 | 666-321-9 | Warning |
Edit chemical label
Print chemical label
[Check your label] |
| Bis(4-chloro-2-nitrophenyl) disulphide | 2050-66-0 | 218-094-9 | Danger |
Edit chemical label
Print chemical label
[Check your label] |